نیکوتین: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
ک clean up, replaced: اولوب ← اوْلوب, اولان ← اوْلان , اولدو ← اوْلدو using AWB |
بدون خلاصۀ ویرایش |
||
خط ۱:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 420440849
| IUPAC_name = (''S'')-3-[1-Methylpyrrolidin-2-yl]pyridine
| image = Nicotine.svg
| image2 = Nicotine-3D-vdW.png
<!--Clinical data -->
| tradename = Nicorette, Nicotrol
| Drugs.com = {{drugs.com|monograph|nicotine}}
| pregnancy_AU = D
| pregnancy_US = D
| legal_AU = Unscheduled
| legal_AU_comment =
| legal_CA = Unscheduled
| legal_CA_comment =
| legal_DE = Unscheduled
| legal_DE_comment =
| legal_NZ = Unscheduled
| legal_NZ_comment =
| legal_UK = Unscheduled
| legal_UK_comment =
| legal_US = Unscheduled
| legal_US_comment =
| legal_UN = Unscheduled
| legal_UN_comment =
| dependency_liability = [[Physical dependence|Physical]]: low–moderate<br />[[Psychological dependence|Psychological]]: moderate–high<ref name=Dependence-withdrawal/><ref>{{cite journal|last1=Cosci|first1=F|last2=Pistelli|first2=F|last3=Lazzarini|first3=N|last4=Carrozzi|first4=L|title=Nicotine dependence and psychological distress: outcomes and clinical implications in smoking cessation.|journal=Psychology research and behavior management|date=2011|volume=4|pages=119–28|pmid=22114542|doi=10.2147/prbm.s14243|pmc=3218785}}</ref>
| addiction_liability = High<ref>{{cite book|author=Mannfred A. Hollinger|title=Introduction to Pharmacology, Third Edition|url=https://books.google.com/books?id=qfrLBQAAQBAJ&pg=PA222#v=onepage&q&f=false|date=19 October 2007|publisher=CRC Press|location=Abingdon|isbn=978-1-4200-4742-4|pages=222–223}}</ref>
| routes_of_administration = [[Inhalation]]; [[Insufflation (medicine)|insufflation]]; [[Oral route|oral]] – buccal, sublingual, and ingestion; [[transdermal]]; [[suppository|rectal]]
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound = <5%
| metabolism = Primarily [[قاراجییر]]: [[CYP2A6]], [[CYP2B6]], [[FMO3]], others
| elimination_half-life = 1-2 hours; 20 hours active metabolite
| metabolites = [[Cotinine]]
| excretion = Urine (10-20% (gum), pH-dependent; 30% (inhaled); 10-30% (intranasal))
<!--Identifiers-->
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 54-11-5
| ATC_prefix = N07
| ATC_suffix = BA01
| ATC_supplemental = {{ATCvet|P53|AX13}}
| ChEBI_Ref = {{Ebicite|changed|EBI}}
| ChEBI = 18723
| PubChem = 89594
| IUPHAR_ligand = 2585
| DrugBank_Ref = {{Drugbankcite|correct|drugbank}}
| DrugBank = DB00184
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 80863
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 6M3C89ZY6R
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = D03365
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 3
| PDB_ligand = NCT
<!--Chemical data-->
| C=10 | H=14 | N=2
| molecular_weight = 162.23 g/mol
| chirality = [[Chiral]]
| smiles = CN(CCC1)[C@@H]1C2=CC=CN=C2
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChI = 1S/C10H14N2/c1-12-7-3-5-10(12)9-4-2-6-11-8-9/h2,4,6,8,10H,3,5,7H2,1H3/t10-/m0/s1
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = SNICXCGAKADSCV-JTQLQIEISA-N
| density = 1.01
| melting_point = -79
| boiling_point = 247
}}
'''نیکوتین ''' ({{اینگیلیسجه|Nicotine}}),بیر [[نیتروژن]]لی [[آلی ترکیب]]دیر.
==قایناقلار==
{{اتکیازی}}
[[بؤلمه:توتون]]
[[بؤلمه:شیمی]]
|