نالوکسان: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
4321bot (دانیشیق | چالیشمالار) ک دواء لار using AWB |
4321bot (دانیشیق | چالیشمالار) Automated import of articles - append on top |
||
خط ۱:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 440816974
| IUPAC_name = (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one
| image = Naloxone.svg
| image2 = Naloxone-3D-balls.png
<!--Clinical data-->
| tradename = Narcan, Evzio, others
| Drugs.com = {{Drugs.com|monograph|naloxone-hydrochloride}}
| pregnancy_AU = B1
| pregnancy_US = C
| pregnancy_US_comment = <ref name=AHFS2015/>
| legal_AU = S3
| legal_AU_comment = <ref>{{cite web | url=https://www.theguardian.com/society/2016/jan/29/selling-opioid-overdose-antidote-naloxone-over-counter-will-save-lives | title=Selling opioid overdose antidote Naloxone over counter 'will save lives' | publisher=The Guardian | date=29 January 2016 | author=Melissa Davey | deadurl=no | archiveurl=https://web.archive.org/web/20161203055245/https://www.theguardian.com/society/2016/jan/29/selling-opioid-overdose-antidote-naloxone-over-counter-will-save-lives | archivedate=3 December 2016 | df= }}</ref>
| legal_DE = Anlage 1
| legal_UK = POM
| routes_of_administration = Endotracheal, intranasal, [[تزریق وریدی]], [[تزریق ماهیچهای]]
<!--Pharmacokinetic data-->
| bioavailability = 2% (Oral, 90% absorption but high [[اثر عبور اول]])
| metabolism = [[قاراجییر]]
| onset = 2 min (IV), 5 min (IM)<ref name=AHFS2015/>
| elimination_half-life = 1–1.5 h
| duration_of_action= 30 to 60 min<ref name=AHFS2015/>
| excretion = Urine, Biliary
<!--Identifiers-->
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 465-65-6
| ATC_prefix = A06
| ATC_suffix = AH04
| ATC_supplemental = <br/>{{ATC|V03|AB15}}
| PubChem = 5284596
| IUPHAR_ligand = 1638
| DrugBank_Ref = {{Drugbankcite|correct|drugbank}}
| DrugBank = DB01183
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 4447644
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 36B82AMQ7N
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = D08249
| ChEBI_Ref = {{Ebicite|changed|EBI}}
| ChEBI = 7459
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 80
<!--Chemical data-->
| C=19 | H=21 | N=1 | O=4
| molecular_weight =
| smiles = O=C1[C@@H]2OC3=C(O)C=CC4=C3[C@@]2([C@]5(CC1)O)CCN(CC=C)[C@@H]5C4
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H21NO4/c1-2-8-20-9-7-18-15-11-3-4-12(21)16(15)24-17(18)13(22)5-6-19(18,23)14(20)10-11/h2-4,14,17,21,23H,1,5-10H2/t14-,17+,18+,19-/m1/s1
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = UZHSEJADLWPNLE-GRGSLBFTSA-N
| synonyms = <small>17-allyl- 4,5α-epoxy- 3,14-dihydroxymorphinan- 6-one</small>
|drug_name=|alt=|caption=|type=|MedlinePlus=|legal_status=|licence_EU=yes|pregnancy_category=|licence_US=|legal_US=Rx only}}
'''نالوکسان''' ([[آیوپاک آدی]]: (4R,4aS,7aR,12bS)-4a,9-dihydroxy-3-prop-2-enyl-2,4,5,6,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-7-one, {{Lang-en|Naloxone}}, {{Lang-zh|納洛酮}}، {{Lang-ar|نالوكسون}}، {{Lang-ru|Налоксон}}) بیر [[بیلشیک|شیمیایی بیلشیک]] [[دواء]].[[متابولیسم|متابولیسمی]] [[قاراجییر]]ده باش وئریر. نالوکسان [[آغری کسیجی]] یا ضد درد اۆچون ایستیفاده اوْلونور.
== بیرده باخ ==
|