لوراتادین: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
4321bot (دانیشیق | چالیشمالار) ک دواء لار using AWB |
4321bot (دانیشیق | چالیشمالار) Automated import of articles - append on top |
||
خط ۱:
{{Infobox drug
| Verifiedfields = changed
| verifiedrevid = 408580634
| drug_name =
| IUPAC_name = Ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate
| image = Loratadine.svg
| image2 = Loratadine - 3d, portrait orientation.png
<!--Clinical data-->
| tradename = Claritin, Claratyne, others
| Drugs.com = {{Drugs.com|monograph|loratadine}}
| MedlinePlus = a697038
| pregnancy_AU = B1
| pregnancy_US = B
| legal_UK = GSL
| legal_US = OTC
| legal_CA = OTC
| routes_of_administration = by mouth
<!--Pharmacokinetic data-->
| bioavailability = almost 100%
| protein_bound = 97–99%
| metabolism = [[قاراجییر]] ([[CYP2D6]]- and [[CYP3A4|3A4]]-mediated)
| elimination_half-life = 8 hours, active metabolite [[دزولراتیدین]] 27 hours
| excretion = 40% as conjugated metabolites into urine<br />Similar amount into the feces
<!--Identifiers-->
| IUPHAR_ligand = 7216
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 79794-75-5
| ATC_prefix = R06
| ATC_suffix = AX13
| PubChem = 3957
| DrugBank_Ref = {{Drugbankcite|changed|drugbank}}
| DrugBank = DB00455
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| ChemSpiderID = 3820
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 7AJO3BO7QN
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = D00364
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 998
<!--Chemical data-->
| C=22 | H=23 | Cl=1 | N=2 | O=2
| molecular_weight = 382.88 g/mol
| smiles = O=C(OCC)N4CC/C(=C2/c1ccc(Cl)cc1CCc3cccnc23)CC4
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H23ClN2O2/c1-2-27-22(26)25-12-9-15(10-13-25)20-19-8-7-18(23)14-17(19)6-5-16-4-3-11-24-21(16)20/h3-4,7-8,11,14H,2,5-6,9-10,12-13H2,1H3
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = JCCNYMKQOSZNPW-UHFFFAOYSA-N
}}
'''لوراتادین''' ([[آیوپاک آدی]]: Ethyl 4-(8-chloro-5,6-dihydro-11H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-ylidene)-1-piperidinecarboxylate, {{Lang-en|Loratadine}}, {{Lang-zh|氯雷他定}}، {{Lang-ar|لوراتادين}}، {{Lang-ru|Лоратадин}}) بیر [[بیلشیک|شیمیایی بیلشیک]] [[دواء]]. بۇ [[دواء|دواءنین]] [[مول جرمی|مول جرمیسی]] مول/قرم ۳۸۲٫۸۸ دیر. [[متابولیسم|متابولیسمی]] [[قاراجییر]]ده باش وئریر.
== بیرده باخ ==
|