هقزاییدین: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
4321bot (دانیشیق | چالیشمالار) ک دواء لار using AWB |
4321bot (دانیشیق | چالیشمالار) Automated import of articles - append on top |
||
خط ۱:
{{Infobox drug
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 447134056
| IUPAC_name = 1,3-bis(2-ethylhexyl)-5-methylhexahydropyrimidin-5-amine
| image = Hexetidine.svg
<!--Clinical data-->
| tradename = Bactidol, others
| Drugs.com = {{Drugs.com|international|hexetidine}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = Not to be used by pregnant women.
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = <!-- GSL / P / POM / CD / Class A, B, C -->
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V -->
| legal_status = OTC
| routes_of_administration = Topical ([[mouthwash]])
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{Cascite|correct|??}}
| CAS_number = 141-94-6
| ATC_prefix = A01
| ATC_suffix = AB12
| ATC_supplemental = {{ATC|G01|AX16}}
| PubChem = 3607
| DrugBank_Ref = {{Drugbankcite|changed|drugbank}}
| DrugBank = DB08958
| UNII_Ref = {{Fdacite|correct|FDA}}
| UNII = 852A84Y8LS
| ChEMBL_Ref = {{Ebicite|changed|EBI}}
| ChEMBL = 144673
| ChemSpiderID_Ref = {{Chemspidercite|changed|chemspider}}
| ChemSpiderID = 32697287
<!--Chemical data-->
| C=21 | H=45 | N=3
| molecular_weight = 339.602 g/mol
| smiles = CCCCC(CC)CN1CC(CN(C1)CC(CC)CCCC)(C)C
| StdInChI_Ref = {{Stdinchicite|changed|chemspider}}
| StdInChI = 1S/C22H46N2/c1-7-11-13-20(9-3)15-23-17-22(5,6)18-24(19-23)16-21(10-4)14-12-8-2/h20-21H,7-19H2,1-6H3
| StdInChIKey_Ref = {{Stdinchicite|changed|chemspider}}
| StdInChIKey = ZSHBZCXOMHHPCE-UHFFFAOYSA-N
}}
'''هقزاییدین''' ([[آیوپاک آدی]]: 1,3-bis(2-ethylhexyl)-5-methylhexahydropyrimidin-5-amine, {{Lang-en|Hexetidine}}, {{Lang-ru|Гексэтидин}}) بیر [[بیلشیک|شیمیایی بیلشیک]] [[دواء]]. بۇ [[دواء|دواءنین]] [[مول جرمی|مول جرمیسی]] مول/قرم ۳۳۹٫۶۰۲ دیر.
== بیرده باخ ==
|