گلوکوز: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
M.XIII (دانیشیق | چالیشمالار) ک «گلوکوز» را محافظت کرد ([دَییشدیر=تکجه اوْتوماتیک تأیید اوْلموش ایشلدنلره ایجازه وئر] (سوْنسۇز)) |
287448 دییشیکلیک 2.186.184.196 (دانیشیق) طرفیندن قایتاریلدی. اِتیکِت: خنثیسازی |
||
خط ۱:
{{Chembox
| verifiedrevid = 818842877
| Name = <small>D</small>-Glucose
| pronounce = {{IPAc-en|ˈ|ɡ|l|uː|k|oʊ|z}}, {{IPAc-en|ˈ|ɡ|l|uː|k|oʊ|s}}
| ImageFile1=Alpha-D-glucopyranose-2D-skeletal.png
| ImageCaption1 = α-<small>D</small>-glucopyranose ([[Cyclohexane conformation|chair form]])
| ImageFile2 = Alpha-D-Glucopyranose.svg
| ImageSize2 = 120
| ImageCaption2 = [[Haworth projection]] of α-<small>D</small>-glucopyranose
| ImageFile3 = D-glucose-chain-2D-Fischer.png
| ImageSize3 = 100
| ImageCaption3 = [[Fischer projection]] of <small>D</small>-glucose
| PIN = <small>D</small>-Glucose
| SystematicName = (2''R'',3''S'',4''R'',5''R'')-2,3,4,5,6-Pentahydroxyhexanal
| OtherNames = Blood sugar<br />Dextrose<br />Corn sugar<br /><small>D</small>-Glucose<br />Grape sugar
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 4536
| Abbreviations = Glc
| CASNo_Ref = {{Cascite|changed|CAS}}
| PubChem = 5793
| ChemSpiderID = 5589
| ChemSpiderID_Ref = {{Chemspidercite|correct|chemspider}}
| UNII = 5SL0G7R0OK
| UNII_Ref = {{Fdacite|correct|FDA}}
| ChEMBL_Ref = {{Ebicite|correct|EBI}}
| ChEMBL = 1222250
| EINECS = 200-075-1
| MeSHName = Glucose
| ChEBI_Ref = {{Ebicite|correct|EBI}}
| ChEBI = 4167
| KEGG_Ref = {{Keggcite|correct|kegg}}
| KEGG = C00031
| RTECS = LZ6600000
| SMILES = OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O
| SMILES1 = C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O)O)O)O)O
| StdInChI_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChI = 1S/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6?/m1/s1
| StdInChIKey_Ref = {{Stdinchicite|correct|chemspider}}
| StdInChIKey = WQZGKKKJIJFFOK-GASJEMHNSA-N
| Beilstein = 1281604
| Gmelin = 83256
| 3DMet = B04623
}}
|Section2={{Chembox Properties
| C=6 | H=12 | O=6
| Appearance = White powder
| MeltingPt = α-<small>D</small>-glucose:
| MeltingPtC = 146
| MeltingPt_notes = <br/>β-<small>D</small>-glucose: 150°C (302°F; 423 K)
| Density = 1.54 g/cm<sup>3</sup>
| Solubility = 909 g/L ({{Convert|25|C}})
| Dipole = 8.6827
| MagSus = −101.5×10<sup>−6</sup> cm<sup>3</sup>/mol
}}
|Section5={{Chembox Thermochemistry
| DeltaHf = −1271 kJ/mol <ref>{{قایناق۱| last1 = Ponomarev | first1 = V. V. | last2 = Migarskaya | first2 = L. B. | title = Heats of combustion of some amino-acids | journal = Russ. J. Phys. Chem. (Engl. Transl.) | year = 1960 | volume = 34 | pages = 1182–83}}</ref>
| DeltaHc = −2805 kJ/mol
| Entropy = 209.2 J K<sup>−1</sup> mol<sup>−1</sup><ref name="Boerio-Goates 1991 403–9">{{قایناق۱| last = Boerio-Goates | first = Juliana | title = Heat-capacity measurements and thermodynamic functions of crystalline α-D-glucose at temperatures from 10K to 340K | journal = J. Chem. Thermodynam. | year = 1991 | volume = 23 | issue = 5 | pages = 403–9 | doi = 10.1016/S0021-9614(05)80128-4}}</ref>
| HeatCapacity = 218.6 J K<sup>−1</sup> mol<sup>−1</sup><ref name="Boerio-Goates 1991 403–9"/>
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = B05
| ATCCode_suffix = CX01
| ATC_Supplemental = {{ATC|V04|CA02}}, {{ATC|V06|DC01}}
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics0865.htm ICSC 08655]
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
}}
}}
'''گلوکوز''' ({{اینگیلیسجه|Glucose}})، [[قان]]دا موجود اوْلان بیر نوع [[قند]]دیر.
== قایناقلار ==▼
فاسجا ویکی پئدیا[http://fa.wikipedia.org/wiki/%DA%AF%D9%84%D9%88%DA%A9%D8%B2]▼
[[بؤلمه:شیمی]]
▲== قایناقلار ==
▲فاسجا ویکی پئدیا[http://fa.wikipedia.org/wiki/%DA%AF%D9%84%D9%88%DA%A9%D8%B2]
|