ساکاروز: نوسخهلر آراسینداکی فرق
محتوای حذفشده محتوای افزودهشده
بدون خلاصۀ ویرایش |
بدون خلاصۀ ویرایش |
||
خط ۱:
{{chembox
| Watchedfields = changed
| verifiedrevid = 458434693
| Name = Sucrose
| ImageFile1 = Saccharose2.svg
| ImageName1 = Skeletal formula of sucrose
| ImageFile2 = Sucrose-rodmodel.png
| ImageName2 = Ball-and-stick model of sucrose
| IUPACName = (2''R'',3''R'',4''S'',5''S'',6''R'')-2-[(2''S'',3''S'',4''S'',5''R'')-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol
| OtherNames = Sugar; Saccharose; α-<small>D</small>-glucopyranosyl-(1→2)-β-<small>D</small>-fructofuranoside;
β-<small>D</small>-fructofuranosyl-(2→1)-α-<small>D</small>-glucopyranoside; β-(2''S'',3''S'',4''S'',5''R'')-fructofuranosyl-α-(1''R'',2''R'',3''S'',4''S'',5''R'')-glucopyranoside; α-(1''R'',2''R'',3''S'',4''S'',5''R'')-glucopyranosyl-β-(2''S'',3''S'',4''S'',5''R'')-fructofuranoside <br />, dodecacarbon monodecahydrate
((2R,3R,4S,5S,6R)-2-[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxapent-2-yl]oxy-6-(hydroxymethyl)oxahexane-3,4,5-triol)
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 5411
| InChI = 1/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| CASNo = 57-50-1
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 253582
| CASNo_Ref = {{cascite|correct|CAS}}
| EC_number = 200-334-9
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5768
| PubChem = 5988
| RTECS = WN6500000
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB02772
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C151H8M554
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 17992
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H22O11/c13-1-4-6(16)8(18)9(19)11(21-4)23-12(3-15)10(20)7(17)5(2-14)22-12/h4-11,13-20H,1-3H2/t4-,5-,6-,7-,8+,9-,10+,11-,12+/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = CZMRCDWAGMRECN-UGDNZRGBSA-N
| SMILES = O1[C@H](CO)[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O[C@@]2(O[C@@H]([C@@H](O)[C@@H]2O)CO)CO
}}
|Section2={{Chembox Properties
| Properties_ref = <ref name="ICSC">{{ICSC-ref|1507|name=Sucrose|date=November 2003}}</ref>
| Formula = C<sub>12</sub>H<sub>22</sub>O<sub>11</sub>
| MolarMass = 342.30 g/mol
| Appearance = white solid
| Density = 1.587 g/cm<sup>3</sup>, solid
| Solubility = ~2000 g/L (25 °C) (see [[#Thermal and oxidative degradation|table]] below for other temperatures)
| MeltingPt = None; decomposes at 186 °C (367 °F; 459 K)
| LogP = −3.76
}}
| Section4 = {{Chembox Thermochemistry
| Thermochemistry_ref =
| HeatCapacity =
| Entropy =
| DeltaHf =
| DeltaGf =
| DeltaHc ={{cvt|1349.6|kcal/mol|kJ/mol}}<ref name=CRC>''[[CRC Handbook of Chemistry and Physics]]'', 49th edition, 1968-1969, p. D-188.</ref> ([[Higher heating value]])}}
|Section3={{Chembox Structure
| CrystalStruct = [[Monoclinic]]
| SpaceGroup = P2<sub>1</sub>
| Dipole =
}}
|Section7={{Chembox Hazards
| ExternalSDS = [http://www.inchem.org/documents/icsc/icsc/eics1507.htm ICSC 1507]
| NFPA-H = 0
| NFPA-F = 1
| NFPA-R = 0
| LD50 = 29700 mg/kg (oral, rat)<ref>{{cite web |url=http://chem.sis.nlm.nih.gov/chemidplus/rn/57-50-1 |title=Archived copy |accessdate=2014-08-10 |deadurl=no |archiveurl=https://web.archive.org/web/20140812222747/http://chem.sis.nlm.nih.gov/chemidplus/rn/57-50-1 |archivedate=2014-08-12 |df= }}</ref>
| PEL = TWA 15 mg/m<sup>3</sup> (total) TWA 5 mg/m<sup>3</sup> (resp)<ref name=PGCH>{{PGCH|0574}}</ref>
| IDLH = N.D.<ref name=PGCH/>
| REL = TWA 10 mg/m<sup>3</sup> (total) TWA 5 mg/m<sup>3</sup> (resp)<ref name=PGCH/>
}}
|Section8={{Chembox Related
| OtherCompounds = [[Lactose]]<br />[[Maltose]]
}}
}}
[[File:Sucrose.gif|thumb|300px|ساکاروز مولکولو]]
| |||