آییراچ ناب پتاسیس

{{chembox| Verifiedfields = changed| Watchedfields = changed| verifiedrevid = 404448904| ImageFile = Petasis reagent V1.svg| ImageSize = 120px| ImageName = Structural formula of the Petasis reagent| ImageFile1 = Petasis-reagent-3D-balls.png| ImageSize1 = 120px | ImageName1 = Ball-and-stick model of the Petasis reagent| IUPACName = Bis(η5-cyclopentadienyl)dimethyltitanium| OtherNames = Dimethyltitanocene|Section1={{Chembox Identifiers| SMILES = C[Ti](C)(C)c.c1cccc1.c2cccc2| ChemSpiderID_Ref =  N| ChemSpiderID = 34981143| InChI = 1/2C5H5.2CH3.Ti/c2

آییراچ ناب پتاسیس

آییراچ ناب پتاسیس (اینگیلیسجه: Petasis reagent, روسجا: Реагент Петасиса) بیر شیمیایی ماده.

بیرده باخ

دَییشدیر

قایناق‌لار

دَییشدیر

اینگیلیسجه ویکی‌پدیاسی‌نین ایشلدنلری طرفیندن یارانمیش «Petasis reagent»، مقاله‌سیندن گؤتورولوبدور. (۲۹ نوْوامبر ۲۰۱۷ تاریخینده یوْخلانیلیبدیر).

قارداش پروژه‌لرده آییراچ ناب پتاسیس گؤره داها آرتیق بیلگی‌لر تاپابیلرسینیز.


  فایل‌لار ویکی‌آمباردا